C24H27N5O — CID 110222904
2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 110222904) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 110222904 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCn1ncc(CN2CCc3c([nH]c4ccc(OC)cc34)C2c2cccnc2)c1C |
| InChI | InChI=1S/C24H27N5O/c1-4-29-16(2)18(14-26-29)15-28-11-9-20-21-12-19(30-3)7-8-22(21)27-23(20)24(28)17-6-5-10-25-13-17/h5-8,10,12-14,24,27H,4,9,11,15H2,1-3H3 |
| InChIKey | MDPPUFHXIDVDEU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|