C23H21N3O — CID 3880139
6-phenylmethoxy-1-pyridin-3-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3880139) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-phenylmethoxy-1-pyridin-3-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-phenylmethoxy-1-pyridin-3-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3880139 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 6-phenylmethoxy-1-pyridin-3-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | c1ccc(COc2ccc3[nH]c4c(c3c2)CCNC4c2cccnc2)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-2-5-16(6-3-1)15-27-18-8-9-21-20(13-18)19-10-12-25-22(23(19)26-21)17-7-4-11-24-14-17/h1-9,11,13-14,22,25-26H,10,12,15H2 |
| InChIKey | RGXIPNJXVMZXQL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|