C24H20Cl2N2O — CID 5038370
1-(2,6-dichlorophenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 5038370) has the molecular formula C24H20Cl2N2O and a molecular weight of 423.34 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1-(2,6-dichlorophenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 5038370 |
| Molecular Formula | C24H20Cl2N2O |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Clc1cccc(Cl)c1C1NCCc2c1[nH]c1ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C24H20Cl2N2O/c25-19-7-4-8-20(26)22(19)24-23-17(11-12-27-24)18-13-16(9-10-21(18)28-23)29-14-15-5-2-1-3-6-15/h1-10,13,24,27-28H,11-12,14H2 |
| InChIKey | ZVYAPDJDGXDDCM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|