C26H26N2O — CID 3282736
1-(3,5-dimethylphenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3282736) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1-(3,5-dimethylphenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3282736 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Cc1cc(C)cc(C2NCCc3c2[nH]c2ccc(OCc4ccccc4)cc32)c1 |
| InChI | InChI=1S/C26H26N2O/c1-17-12-18(2)14-20(13-17)25-26-22(10-11-27-25)23-15-21(8-9-24(23)28-26)29-16-19-6-4-3-5-7-19/h3-9,12-15,25,27-28H,10-11,16H2,1-2H3 |
| InChIKey | QQOVDYIOYCUMSF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|