C20H21FN2O — CID 3950884
6-ethoxy-1-(3-fluoro-5-methylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3950884) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is 6-ethoxy-1-(3-fluoro-5-methylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-ethoxy-1-(3-fluoro-5-methylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3950884 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 6-ethoxy-1-(3-fluoro-5-methylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)CCNC3c1cc(C)cc(F)c1 |
| InChI | InChI=1S/C20H21FN2O/c1-3-24-15-4-5-18-17(11-15)16-6-7-22-19(20(16)23-18)13-8-12(2)9-14(21)10-13/h4-5,8-11,19,22-23H,3,6-7H2,1-2H3 |
| InChIKey | FUZNNFVLNKFEQL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|