C23H29N3O2 — CID 4986997
2-[4-(6-ethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-N,N-dimethylethanamine (PubChem CID 4986997) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[4-(6-ethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-(6-ethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 4986997 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-[4-(6-ethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenoxy]-N,N-dimethylethanamine |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)CCNC3c1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-4-27-18-9-10-21-20(15-18)19-11-12-24-22(23(19)25-21)16-5-7-17(8-6-16)28-14-13-26(2)3/h5-10,15,22,24-25H,4,11-14H2,1-3H3 |
| InChIKey | ZPUNHBABMWFADB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|