C20H23N3O — CID 95802692
(1S)-6-methoxy-2-propan-2-yl-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 95802692) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (1S)-6-methoxy-2-propan-2-yl-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-6-methoxy-2-propan-2-yl-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 95802692 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (1S)-6-methoxy-2-propan-2-yl-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(C)C)[C@H]3c1cccnc1 |
| InChI | InChI=1S/C20H23N3O/c1-13(2)23-10-8-16-17-11-15(24-3)6-7-18(17)22-19(16)20(23)14-5-4-9-21-12-14/h4-7,9,11-13,20,22H,8,10H2,1-3H3/t20-/m0/s1 |
| InChIKey | IGJYEFICYLYPHR-FQEVSTJZSA-N |
| XLogP | 3.93 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|