C19H16N2O2 — CID 3436174
16-methoxy-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one (PubChem CID 3436174) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 16-methoxy-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one.
| Compound Name | 16-methoxy-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one |
|---|---|
| PubChem CID | 3436174 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 16-methoxy-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)c2ccccc2C31 |
| InChI | InChI=1S/C19H16N2O2/c1-23-11-6-7-16-15(10-11)12-8-9-21-18(17(12)20-16)13-4-2-3-5-14(13)19(21)22/h2-7,10,18,20H,8-9H2,1H3 |
| InChIKey | DWHIPRRZWKTEEK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|