C20H18N2O4 — CID 122185180
7,19-dimethoxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one (PubChem CID 122185180) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 7,19-dimethoxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one.
| Compound Name | 7,19-dimethoxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
|---|---|
| PubChem CID | 122185180 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 7,19-dimethoxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)c2cccc(OC)c2OC31 |
| InChI | InChI=1S/C20H18N2O4/c1-24-11-6-7-15-14(10-11)12-8-9-22-19(23)13-4-3-5-16(25-2)18(13)26-20(22)17(12)21-15/h3-7,10,20-21H,8-9H2,1-2H3 |
| InChIKey | SVEVACWFROAWPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|