C21H20N2O2 — CID 139092958
(1S)-7-methoxy-1-methyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one (PubChem CID 139092958) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S)-7-methoxy-1-methyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one.
| Compound Name | (1S)-7-methoxy-1-methyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one |
|---|---|
| PubChem CID | 139092958 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (1S)-7-methoxy-1-methyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)Cc2ccccc2[C@@]31C |
| InChI | InChI=1S/C21H20N2O2/c1-21-17-6-4-3-5-13(17)11-19(24)23(21)10-9-15-16-12-14(25-2)7-8-18(16)22-20(15)21/h3-8,12,22H,9-11H2,1-2H3/t21-/m0/s1 |
| InChIKey | BYWYQQLNEKZIJM-NRFANRHFSA-N |
| XLogP | 3.38 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |