C21H19N4O5- — CID 163156604
(2S)-4-[4-[hydroxy(oxido)amino]phenyl]-12-methoxy-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraene-3,5-dione (PubChem CID 163156604) has the molecular formula C21H19N4O5- and a molecular weight of 407.41 g/mol. Its IUPAC name is (2S)-4-[4-[hydroxy(oxido)amino]phenyl]-12-methoxy-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraene-3,5-dione.
| Compound Name | (2S)-4-[4-[hydroxy(oxido)amino]phenyl]-12-methoxy-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraene-3,5-dione |
|---|---|
| PubChem CID | 163156604 |
| Molecular Formula | C21H19N4O5- |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (2S)-4-[4-[hydroxy(oxido)amino]phenyl]-12-methoxy-2-methyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraene-3,5-dione |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N(c2ccc(N([O-])O)cc2)C(=O)[C@]31C |
| InChI | InChI=1S/C21H19N4O5/c1-21-18-15(16-11-14(30-2)7-8-17(16)22-18)9-10-23(21)20(27)24(19(21)26)12-3-5-13(6-4-12)25(28)29/h3-8,11,22,28H,9-10H2,1-2H3/q-1/t21-/m0/s1 |
| InChIKey | CVDHRZOFYFSFIQ-NRFANRHFSA-N |
| XLogP | 3.11 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|