C30H28N4O4 — CID 3749392
2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)-N-(1-phenylethyl)benzamide (PubChem CID 3749392) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)-N-(1-phenylethyl)benzamide.
| Compound Name | 2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3749392 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)-N-(1-phenylethyl)benzamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N(c2ccccc2C(=O)NC(C)c2ccccc2)C(=O)C31C |
| InChI | InChI=1S/C30H28N4O4/c1-18(19-9-5-4-6-10-19)31-27(35)22-11-7-8-12-25(22)34-28(36)30(2)26-21(15-16-33(30)29(34)37)23-17-20(38-3)13-14-24(23)32-26/h4-14,17-18,32H,15-16H2,1-3H3,(H,31,35) |
| InChIKey | QXCOZRQGZHCEPU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|