C30H36N4O4 — CID 40872607
4-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]-N-[(2R)-6-methylheptan-2-yl]benzamide (PubChem CID 40872607) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 4-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]-N-[(2R)-6-methylheptan-2-yl]benzamide.
| Compound Name | 4-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]-N-[(2R)-6-methylheptan-2-yl]benzamide |
|---|---|
| PubChem CID | 40872607 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 4-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]-N-[(2R)-6-methylheptan-2-yl]benzamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N(c2ccc(C(=O)N[C@H](C)CCCC(C)C)cc2)C(=O)[C@]31C |
| InChI | InChI=1S/C30H36N4O4/c1-18(2)7-6-8-19(3)31-27(35)20-9-11-21(12-10-20)34-28(36)30(4)26-23(15-16-33(30)29(34)37)24-17-22(38-5)13-14-25(24)32-26/h9-14,17-19,32H,6-8,15-16H2,1-5H3,(H,31,35)/t19-,30+/m1/s1 |
| InChIKey | DNDFLZUSGWCCMK-QTEAWJPNSA-N |
| XLogP | 5.36 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|