C31H30N4O6 — CID 6571493
N-[(2,4-dimethoxyphenyl)methyl]-2-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]benzamide (PubChem CID 6571493) has the molecular formula C31H30N4O6 and a molecular weight of 554.60 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]benzamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]benzamide |
|---|---|
| PubChem CID | 6571493 |
| Molecular Formula | C31H30N4O6 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2-[(2S)-12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2N2C(=O)N3CCc4c([nH]c5ccc(OC)cc45)[C@@]3(C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C31H30N4O6/c1-31-27-21(23-15-19(39-2)11-12-24(23)33-27)13-14-34(31)30(38)35(29(31)37)25-8-6-5-7-22(25)28(36)32-17-18-9-10-20(40-3)16-26(18)41-4/h5-12,15-16,33H,13-14,17H2,1-4H3,(H,32,36)/t31-/m0/s1 |
| InChIKey | YVCLHVZUMXHDRO-HKBQPEDESA-N |
| XLogP | 4.36 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|