C30H28N4O5 — CID 6570759
N-[(3,4-dimethoxyphenyl)methyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide (PubChem CID 6570759) has the molecular formula C30H28N4O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide |
|---|---|
| PubChem CID | 6570759 |
| Molecular Formula | C30H28N4O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2N2C(=O)N3CCc4c([nH]c5ccccc45)[C@@]3(C)C2=O)cc1OC |
| InChI | InChI=1S/C30H28N4O5/c1-30-26-20(19-8-4-6-10-22(19)32-26)14-15-33(30)29(37)34(28(30)36)23-11-7-5-9-21(23)27(35)31-17-18-12-13-24(38-2)25(16-18)39-3/h4-13,16,32H,14-15,17H2,1-3H3,(H,31,35)/t30-/m0/s1 |
| InChIKey | UGPQHUYVFSSPKI-PMERELPUSA-N |
| XLogP | 4.36 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|