C29H34N4O5 — CID 4837078
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)butanamide (PubChem CID 4837078) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)butanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)butanamide |
|---|---|
| PubChem CID | 4837078 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)butanamide |
| SMILES | COc1ccc(CCNC(=O)C(C(C)C)N2C(=O)N3CCc4c([nH]c5ccccc45)C3(C)C2=O)cc1OC |
| InChI | InChI=1S/C29H34N4O5/c1-17(2)24(26(34)30-14-12-18-10-11-22(37-4)23(16-18)38-5)33-27(35)29(3)25-20(13-15-32(29)28(33)36)19-8-6-7-9-21(19)31-25/h6-11,16-17,24,31H,12-15H2,1-5H3,(H,30,34) |
| InChIKey | XTSSAQIDDTYLLN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|