C23H28N4O5 — CID 18398043
(2R)-2-[[(2R)-4-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]pentanoyl]amino]propanoic acid (PubChem CID 18398043) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is (2R)-2-[[(2R)-4-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]pentanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2R)-4-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18398043 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (2R)-2-[[(2R)-4-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]pentanoyl]amino]propanoic acid |
| SMILES | CC(C)C[C@H](C(=O)N[C@H](C)C(=O)O)N1C(=O)N2CCc3c([nH]c4ccccc34)[C@@]2(C)C1=O |
| InChI | InChI=1S/C23H28N4O5/c1-12(2)11-17(19(28)24-13(3)20(29)30)27-21(31)23(4)18-15(9-10-26(23)22(27)32)14-7-5-6-8-16(14)25-18/h5-8,12-13,17,25H,9-11H2,1-4H3,(H,24,28)(H,29,30)/t13-,17-,23+/m1/s1 |
| InChIKey | XIIBSDVOMUVKRA-MBSYMSIGSA-N |
| XLogP | 2.21 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|