C25H32N4O5 — CID 4835510
3-methyl-2-[[4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)pentanoyl]amino]butanoic acid (PubChem CID 4835510) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-methyl-2-[[4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)pentanoyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)pentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 4835510 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 3-methyl-2-[[4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)pentanoyl]amino]butanoic acid |
| SMILES | CC(C)CC(C(=O)NC(C(=O)O)C(C)C)N1C(=O)N2CCc3c([nH]c4ccccc34)C2(C)C1=O |
| InChI | InChI=1S/C25H32N4O5/c1-13(2)12-18(21(30)27-19(14(3)4)22(31)32)29-23(33)25(5)20-16(10-11-28(25)24(29)34)15-8-6-7-9-17(15)26-20/h6-9,13-14,18-19,26H,10-12H2,1-5H3,(H,27,30)(H,31,32) |
| InChIKey | VJVAHPQSCCPZMJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|