C23H30N4O3 — CID 4835774
4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-propylpentanamide (PubChem CID 4835774) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-propylpentanamide.
| Compound Name | 4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-propylpentanamide |
|---|---|
| PubChem CID | 4835774 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-methyl-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-propylpentanamide |
| SMILES | CCCNC(=O)C(CC(C)C)N1C(=O)N2CCc3c([nH]c4ccccc34)C2(C)C1=O |
| InChI | InChI=1S/C23H30N4O3/c1-5-11-24-20(28)18(13-14(2)3)27-21(29)23(4)19-16(10-12-26(23)22(27)30)15-8-6-7-9-17(15)25-19/h6-9,14,18,25H,5,10-13H2,1-4H3,(H,24,28) |
| InChIKey | SXWGBHRNNAAWBT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|