C24H23ClN4O3 — CID 3249337
N-[(3-chlorophenyl)methyl]-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)propanamide (PubChem CID 3249337) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)propanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)propanamide |
|---|---|
| PubChem CID | 3249337 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)propanamide |
| SMILES | CC(C(=O)NCc1cccc(Cl)c1)N1C(=O)N2CCc3c([nH]c4ccccc34)C2(C)C1=O |
| InChI | InChI=1S/C24H23ClN4O3/c1-14(21(30)26-13-15-6-5-7-16(25)12-15)29-22(31)24(2)20-18(10-11-28(24)23(29)32)17-8-3-4-9-19(17)27-20/h3-9,12,14,27H,10-11,13H2,1-2H3,(H,26,30) |
| InChIKey | QFYFVHRCQZYWLM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|