C28H23ClN4O3 — CID 6571098
N-[(4-chlorophenyl)methyl]-3-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide (PubChem CID 6571098) has the molecular formula C28H23ClN4O3 and a molecular weight of 498.97 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide |
|---|---|
| PubChem CID | 6571098 |
| Molecular Formula | C28H23ClN4O3 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide |
| SMILES | C[C@]12C(=O)N(c3cccc(C(=O)NCc4ccc(Cl)cc4)c3)C(=O)N1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C28H23ClN4O3/c1-28-24-22(21-7-2-3-8-23(21)31-24)13-14-32(28)27(36)33(26(28)35)20-6-4-5-18(15-20)25(34)30-16-17-9-11-19(29)12-10-17/h2-12,15,31H,13-14,16H2,1H3,(H,30,34)/t28-/m0/s1 |
| InChIKey | SLBXTLUQPKUSGO-NDEPHWFRSA-N |
| XLogP | 4.99 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|