C19H20N3O4- — CID 7092742
(2S)-3-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]butanoate (PubChem CID 7092742) has the molecular formula C19H20N3O4- and a molecular weight of 354.39 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]butanoate.
| Compound Name | (2S)-3-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]butanoate |
|---|---|
| PubChem CID | 7092742 |
| Molecular Formula | C19H20N3O4- |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2S)-3-methyl-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]butanoate |
| SMILES | CC(C)[C@@H](C(=O)[O-])N1C(=O)N2CCc3c([nH]c4ccccc34)[C@@]2(C)C1=O |
| InChI | InChI=1S/C19H21N3O4/c1-10(2)14(16(23)24)22-17(25)19(3)15-12(8-9-21(19)18(22)26)11-6-4-5-7-13(11)20-15/h4-7,10,14,20H,8-9H2,1-3H3,(H,23,24)/p-1/t14-,19-/m0/s1 |
| InChIKey | NWWVCEJQYCCAIN-LIRRHRJNSA-M |
| XLogP | 0.98 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|