C26H32N4O4 — CID 3674781
N-[2-(cyclohexen-1-yl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide (PubChem CID 3674781) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide |
|---|---|
| PubChem CID | 3674781 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N(C(C)C(=O)NCCC2=CCCCC2)C(=O)C31C |
| InChI | InChI=1S/C26H32N4O4/c1-16(23(31)27-13-11-17-7-5-4-6-8-17)30-24(32)26(2)22-19(12-14-29(26)25(30)33)20-15-18(34-3)9-10-21(20)28-22/h7,9-10,15-16,28H,4-6,8,11-14H2,1-3H3,(H,27,31) |
| InChIKey | WMYQFZTYYJFAAC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|