C28H32N4O6 — CID 4639412
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide (PubChem CID 4639412) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide |
|---|---|
| PubChem CID | 4639412 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)propanamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N(C(C)C(=O)NCCc2ccc(OC)c(OC)c2)C(=O)C31C |
| InChI | InChI=1S/C28H32N4O6/c1-16(25(33)29-12-10-17-6-9-22(37-4)23(14-17)38-5)32-26(34)28(2)24-19(11-13-31(28)27(32)35)20-15-18(36-3)7-8-21(20)30-24/h6-9,14-16,30H,10-13H2,1-5H3,(H,29,33) |
| InChIKey | AQALIPJQSSFUAL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|