C27H31N5O4 — CID 5129868
N-[3-(dimethylamino)propyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)benzamide (PubChem CID 5129868) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)benzamide |
|---|---|
| PubChem CID | 5129868 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(12-methoxy-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10(15),11,13-tetraen-4-yl)benzamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C(=O)N(c2ccccc2C(=O)NCCCN(C)C)C(=O)C31C |
| InChI | InChI=1S/C27H31N5O4/c1-27-23-18(20-16-17(36-4)10-11-21(20)29-23)12-15-31(27)26(35)32(25(27)34)22-9-6-5-8-19(22)24(33)28-13-7-14-30(2)3/h5-6,8-11,16,29H,7,12-15H2,1-4H3,(H,28,33) |
| InChIKey | XIECZEJRQIYTDX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|