C29H30N4O3 — CID 6571371
N-[2-(cyclohexen-1-yl)ethyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide (PubChem CID 6571371) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide |
|---|---|
| PubChem CID | 6571371 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2S)-2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl]benzamide |
| SMILES | C[C@]12C(=O)N(c3ccccc3C(=O)NCCC3=CCCCC3)C(=O)N1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C29H30N4O3/c1-29-25-21(20-11-5-7-13-23(20)31-25)16-18-32(29)28(36)33(27(29)35)24-14-8-6-12-22(24)26(34)30-17-15-19-9-3-2-4-10-19/h5-9,11-14,31H,2-4,10,15-18H2,1H3,(H,30,34)/t29-/m0/s1 |
| InChIKey | NWQHUOHAWSYDSB-LJAQVGFWSA-N |
| XLogP | 5.03 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|