C25H26N2O — CID 71567703
(1R)-1-ethyl-6-methoxy-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 71567703) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is (1R)-1-ethyl-6-methoxy-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-1-ethyl-6-methoxy-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 71567703 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (1R)-1-ethyl-6-methoxy-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC[C@@H]1c2[nH]c3ccc(OC)cc3c2CCN1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C25H26N2O/c1-3-24-25-21(22-15-19(28-2)11-12-23(22)26-25)13-14-27(24)16-18-9-6-8-17-7-4-5-10-20(17)18/h4-12,15,24,26H,3,13-14,16H2,1-2H3/t24-/m1/s1 |
| InChIKey | GMUKLEVYHMQVFG-XMMPIXPASA-N |
| XLogP | 5.84 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|