C22H26N2O3 — CID 46968066
1-(2,5-dimethoxyphenyl)-2-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanol (PubChem CID 46968066) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanol |
|---|---|
| PubChem CID | 46968066 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanol |
| SMILES | COc1ccc(OC)c(C(O)CN2CCc3c([nH]c4ccccc34)C2C)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-14-22-17(16-6-4-5-7-19(16)23-22)10-11-24(14)13-20(25)18-12-15(26-2)8-9-21(18)27-3/h4-9,12,14,20,23,25H,10-11,13H2,1-3H3 |
| InChIKey | UNIQDOGKVALDTM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|