C17H27NO3 — CID 62332362
1-(2,5-dimethoxyphenyl)-2-(2,4-dimethylpiperidin-1-yl)ethanol (PubChem CID 62332362) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(2,4-dimethylpiperidin-1-yl)ethanol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(2,4-dimethylpiperidin-1-yl)ethanol |
|---|---|
| PubChem CID | 62332362 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(2,4-dimethylpiperidin-1-yl)ethanol |
| SMILES | COc1ccc(OC)c(C(O)CN2CCC(C)CC2C)c1 |
| InChI | InChI=1S/C17H27NO3/c1-12-7-8-18(13(2)9-12)11-16(19)15-10-14(20-3)5-6-17(15)21-4/h5-6,10,12-13,16,19H,7-9,11H2,1-4H3 |
| InChIKey | SUOZBZKSEJCQIX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |