C22H24N2O — CID 141353723
(12S)-12-ethyl-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene (PubChem CID 141353723) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (12S)-12-ethyl-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene.
| Compound Name | (12S)-12-ethyl-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene |
|---|---|
| PubChem CID | 141353723 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (12S)-12-ethyl-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene |
| SMILES | CC[C@H]1c2[nH]c3ccccc3c2CC2c3cc(OC)ccc3CCN21 |
| InChI | InChI=1S/C22H24N2O/c1-3-20-22-18(16-6-4-5-7-19(16)23-22)13-21-17-12-15(25-2)9-8-14(17)10-11-24(20)21/h4-9,12,20-21,23H,3,10-11,13H2,1-2H3/t20-,21?/m0/s1 |
| InChIKey | SZJMTCOAZRJMHK-BGERDNNASA-N |
| XLogP | 4.78 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|