C26H23FN2O — CID 141353710
(12S)-12-(4-fluorophenyl)-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene (PubChem CID 141353710) has the molecular formula C26H23FN2O and a molecular weight of 398.48 g/mol. Its IUPAC name is (12S)-12-(4-fluorophenyl)-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene.
| Compound Name | (12S)-12-(4-fluorophenyl)-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene |
|---|---|
| PubChem CID | 141353710 |
| Molecular Formula | C26H23FN2O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (12S)-12-(4-fluorophenyl)-19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaene |
| SMILES | COc1ccc2c(c1)C1Cc3c([nH]c4ccccc34)[C@H](c3ccc(F)cc3)N1CC2 |
| InChI | InChI=1S/C26H23FN2O/c1-30-19-11-8-16-12-13-29-24(21(16)14-19)15-22-20-4-2-3-5-23(20)28-25(22)26(29)17-6-9-18(27)10-7-17/h2-11,14,24,26,28H,12-13,15H2,1H3/t24?,26-/m0/s1 |
| InChIKey | FXXUCPZQVUSXCW-JKGBFCRXSA-N |
| XLogP | 5.56 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|