C35H33FN2O4 — CID 131978790
12-(4-fluorophenyl)-6,19-dimethoxy-18-[(3-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene (PubChem CID 131978790) has the molecular formula C35H33FN2O4 and a molecular weight of 564.66 g/mol. Its IUPAC name is 12-(4-fluorophenyl)-6,19-dimethoxy-18-[(3-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene.
| Compound Name | 12-(4-fluorophenyl)-6,19-dimethoxy-18-[(3-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
|---|---|
| PubChem CID | 131978790 |
| Molecular Formula | C35H33FN2O4 |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 12-(4-fluorophenyl)-6,19-dimethoxy-18-[(3-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
| SMILES | COc1cccc(COc2cc3c(cc2OC)C2Cc4c([nH]c5ccc(OC)cc45)C(c4ccc(F)cc4)N2CC3)c1 |
| InChI | InChI=1S/C35H33FN2O4/c1-39-25-6-4-5-21(15-25)20-42-33-16-23-13-14-38-31(27(23)19-32(33)41-3)18-29-28-17-26(40-2)11-12-30(28)37-34(29)35(38)22-7-9-24(36)10-8-22/h4-12,15-17,19,31,35,37H,13-14,18,20H2,1-3H3 |
| InChIKey | DGKJADLWPQKQSL-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 55.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|