C34H30B17ClFN2O3 — CID 159404668
CID 159404668 (PubChem CID 159404668) has the molecular formula C34H30B17ClFN2O3 and a molecular weight of 752.88 g/mol.
| Compound Name | CID 159404668 |
|---|---|
| PubChem CID | 159404668 |
| Molecular Formula | C34H30B17ClFN2O3 |
| Molecular Weight | 752.88 g/mol |
| Exact Mass | 755.35 |
| IUPAC Name | — |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1c2cc(OCc4ccc(Cl)cc4)c(OC)cc2CCN1C3c1ccc(F)cc1.[B][B]B(B([B])[B])B(B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C34H30ClFN2O3.B17/c1-39-25-11-12-29-27(16-25)28-17-30-26-18-32(41-19-20-3-7-23(35)8-4-20)31(40-2)15-22(26)13-14-38(30)34(33(28)37-29)21-5-9-24(36)10-6-21;1-10-15(11(2)3)17(14(8)9)16(12(4)5)13(6)7/h3-12,15-16,18,30,34,37H,13-14,17,19H2,1-2H3; |
| InChIKey | CBVHBIVOTVMAGX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.88 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|