C33H28B49BrFN2O2 — CID 160965577
CID 160965577 (PubChem CID 160965577) has the molecular formula C33H28B49BrFN2O2 and a molecular weight of 1113.29 g/mol.
| Compound Name | CID 160965577 |
|---|---|
| PubChem CID | 160965577 |
| Molecular Formula | C33H28B49BrFN2O2 |
| Molecular Weight | 1113.29 g/mol |
| Exact Mass | 1121.59 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1OCc1ccccc1)C1Cc3c([nH]c4cc(Br)ccc34)C(c3ccc(F)cc3)N1CC2.[B][B]B(B([B])[B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C33H28BrFN2O2.B49/c1-38-30-15-22-13-14-37-29(26(22)18-31(30)39-19-20-5-3-2-4-6-20)17-27-25-12-9-23(34)16-28(25)36-32(27)33(37)21-7-10-24(35)11-8-21;1-26-39(27(2)3)45(38(24)25)48(44(36(20)21)37(22)23)49(46(40(28(4)5)29(6)7)41(30(8)9)31(10)11)47(42(32(12)13)33(14)15)43(34(16)17)35(18)19/h2-12,15-16,18,29,33,36H,13-14,17,19H2,1H3; |
| InChIKey | CVYSGNRPCCQZDG-UHFFFAOYSA-N |
| XLogP | -10.76 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 88 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.29 |
| LogP ≤ 5 | -10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|