C35H32B23F2N2O3 — CID 159334085
CID 159334085 (PubChem CID 159334085) has the molecular formula C35H32B23F2N2O3 and a molecular weight of 815.32 g/mol.
| Compound Name | CID 159334085 |
|---|---|
| PubChem CID | 159334085 |
| Molecular Formula | C35H32B23F2N2O3 |
| Molecular Weight | 815.32 g/mol |
| Exact Mass | 819.45 |
| IUPAC Name | — |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1c2cc(OCc4ccc(C)c(F)c4)c(OC)cc2CCN1C3c1ccc(F)cc1.[B][B]B([B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C35H32F2N2O3.B23/c1-20-4-5-21(14-29(20)37)19-42-33-18-26-23(15-32(33)41-3)12-13-39-31(26)17-28-27-16-25(40-2)10-11-30(27)38-34(28)35(39)22-6-8-24(36)9-7-22;1-13-19(12)22(18(10)11)23(20(14(2)3)15(4)5)21(16(6)7)17(8)9/h4-11,14-16,18,31,35,38H,12-13,17,19H2,1-3H3; |
| InChIKey | QUUMCXNBUAVUMQ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 46.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.32 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|