C27H25FN2O2 — CID 147615918
(1S)-12-(4-fluorophenyl)-18,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaene (PubChem CID 147615918) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is (1S)-12-(4-fluorophenyl)-18,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaene.
| Compound Name | (1S)-12-(4-fluorophenyl)-18,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaene |
|---|---|
| PubChem CID | 147615918 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (1S)-12-(4-fluorophenyl)-18,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaene |
| SMILES | COc1cc2c(cc1OC)[C@@H]1Cc3c([nH]c4ccccc34)C(c3ccc(F)cc3)N1CC2 |
| InChI | InChI=1S/C27H25FN2O2/c1-31-24-13-17-11-12-30-23(20(17)15-25(24)32-2)14-21-19-5-3-4-6-22(19)29-26(21)27(30)16-7-9-18(28)10-8-16/h3-10,13,15,23,27,29H,11-12,14H2,1-2H3/t23-,27?/m0/s1 |
| InChIKey | GCXQFJYTSOAXFB-DCCUJTHKSA-N |
| XLogP | 5.57 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|