C27H25FN2O2 — CID 145375342
12-(4-fluorophenyl)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene (PubChem CID 145375342) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 12-(4-fluorophenyl)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene.
| Compound Name | 12-(4-fluorophenyl)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene |
|---|---|
| PubChem CID | 145375342 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 12-(4-fluorophenyl)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene |
| SMILES | COc1ccc2c(c1)C1Cc3c([nH]c4ccc(OC)cc34)C(c3ccc(F)cc3)N1CC2 |
| InChI | InChI=1S/C27H25FN2O2/c1-31-19-8-5-16-11-12-30-25(21(16)13-19)15-23-22-14-20(32-2)9-10-24(22)29-26(23)27(30)17-3-6-18(28)7-4-17/h3-10,13-14,25,27,29H,11-12,15H2,1-2H3 |
| InChIKey | KBBCPIXMKIBMAO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|