C20H20N2O — CID 11012165
(1S)-18-methoxy-1,3,11,12,14,21-hexahydroyohimban (PubChem CID 11012165) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (1S)-18-methoxy-1,3,11,12,14,21-hexahydroyohimban.
| Compound Name | (1S)-18-methoxy-1,3,11,12,14,21-hexahydroyohimban |
|---|---|
| PubChem CID | 11012165 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (1S)-18-methoxy-1,3,11,12,14,21-hexahydroyohimban |
| SMILES | COc1ccc2c(c1)C[C@H]1c3[nH]c4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C20H20N2O/c1-23-15-7-6-13-12-22-9-8-17-16-4-2-3-5-18(16)21-20(17)19(22)11-14(13)10-15/h2-7,10,19,21H,8-9,11-12H2,1H3/t19-/m0/s1 |
| InChIKey | CJFJXYGEGHXRNB-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|