C24H32N2OSi2 — CID 11318968
5,7-bis(trimethylsilyl)-10,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),4,7,14,16,18-hexaen-6-one (PubChem CID 11318968) has the molecular formula C24H32N2OSi2 and a molecular weight of 420.71 g/mol. Its IUPAC name is 5,7-bis(trimethylsilyl)-10,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),4,7,14,16,18-hexaen-6-one.
| Compound Name | 5,7-bis(trimethylsilyl)-10,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),4,7,14,16,18-hexaen-6-one |
|---|---|
| PubChem CID | 11318968 |
| Molecular Formula | C24H32N2OSi2 |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 5,7-bis(trimethylsilyl)-10,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),4,7,14,16,18-hexaen-6-one |
| SMILES | C[Si](C)(C)C1=C2CC3c4[nH]c5ccccc5c4CCN3CC2=C([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C24H32N2OSi2/c1-28(2,3)23-17-13-20-21-16(15-9-7-8-10-19(15)25-21)11-12-26(20)14-18(17)24(22(23)27)29(4,5)6/h7-10,20,25H,11-14H2,1-6H3 |
| InChIKey | WLBWKQPPMIFKCU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|