C21H28N2OSi — CID 5388241
2-[(Z)-1-trimethylsilylprop-1-enyl]-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one (PubChem CID 5388241) has the molecular formula C21H28N2OSi and a molecular weight of 352.55 g/mol. Its IUPAC name is 2-[(Z)-1-trimethylsilylprop-1-enyl]-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one.
| Compound Name | 2-[(Z)-1-trimethylsilylprop-1-enyl]-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 5388241 |
| Molecular Formula | C21H28N2OSi |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[(Z)-1-trimethylsilylprop-1-enyl]-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
| SMILES | C/C=C(/C1CC(=O)N2CCc3c([nH]c4ccccc34)C2C1)[Si](C)(C)C |
| InChI | InChI=1S/C21H28N2OSi/c1-5-19(25(2,3)4)14-12-18-21-16(10-11-23(18)20(24)13-14)15-8-6-7-9-17(15)22-21/h5-9,14,18,22H,10-13H2,1-4H3/b19-5- |
| InChIKey | TZWVABNTPXWRTO-IPKBDRFQSA-N |
| XLogP | 4.83 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|