C19H22N2S — CID 165342227
2-(2-methylidenebutyl)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-3-thione (PubChem CID 165342227) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 2-(2-methylidenebutyl)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-3-thione.
| Compound Name | 2-(2-methylidenebutyl)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-3-thione |
|---|---|
| PubChem CID | 165342227 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-(2-methylidenebutyl)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-3-thione |
| SMILES | C=C(CC)CC1CC2c3[nH]c4ccccc4c3CCN2C1=S |
| InChI | InChI=1S/C19H22N2S/c1-3-12(2)10-13-11-17-18-15(8-9-21(17)19(13)22)14-6-4-5-7-16(14)20-18/h4-7,13,17,20H,2-3,8-11H2,1H3 |
| InChIKey | ZCTVPOHBLQAVHQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|