C19H20N2O3 — CID 10990953
(1S,15R,16S,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,18-dione (PubChem CID 10990953) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (1S,15R,16S,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,18-dione.
| Compound Name | (1S,15R,16S,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,18-dione |
|---|---|
| PubChem CID | 10990953 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (1S,15R,16S,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,18-dione |
| SMILES | C[C@@H]1OC(=O)C[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3C(=O)[C@H]21 |
| InChI | InChI=1S/C19H20N2O3/c1-10-17-11(9-16(22)24-10)8-15-18-13(6-7-21(15)19(17)23)12-4-2-3-5-14(12)20-18/h2-5,10-11,15,17,20H,6-9H2,1H3/t10-,11+,15-,17-/m0/s1 |
| InChIKey | DIGQIDPWBIGDIV-RERORNDZSA-N |
| XLogP | 2.57 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|