C26H29N3O4 — CID 75248051
2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-3-(1-hydroxyethyl)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one (PubChem CID 75248051) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-3-(1-hydroxyethyl)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-3-(1-hydroxyethyl)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 75248051 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-3-(1-hydroxyethyl)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
| SMILES | CC(O)C1C(=O)N2CCc3c([nH]c4ccccc34)C2CC1N(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H29N3O4/c1-15(30)24-20(28(2)13-16-7-8-22-23(11-16)33-14-32-22)12-21-25-18(9-10-29(21)26(24)31)17-5-3-4-6-19(17)27-25/h3-8,11,15,20-21,24,27,30H,9-10,12-14H2,1-2H3 |
| InChIKey | CFNBSJDMYAEBMY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|