C29H30N4O3 — CID 51361006
1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-1-methyl-3-naphthalen-1-ylurea (PubChem CID 51361006) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-1-methyl-3-naphthalen-1-ylurea.
| Compound Name | 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-1-methyl-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 51361006 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-1-methyl-3-naphthalen-1-ylurea |
| SMILES | C[C@H](O)[C@@H]1C(=O)N2CCc3c([nH]c4ccccc34)[C@@H]2C[C@@H]1N(C)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C29H30N4O3/c1-17(34)26-24(32(2)29(36)31-22-13-7-9-18-8-3-4-10-19(18)22)16-25-27-21(14-15-33(25)28(26)35)20-11-5-6-12-23(20)30-27/h3-13,17,24-26,30,34H,14-16H2,1-2H3,(H,31,36)/t17-,24-,25-,26-/m0/s1 |
| InChIKey | WIJOKHDKODQEDL-QQMCDRLVSA-N |
| XLogP | 4.68 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|