C17H16N2O3 — CID 10756340
methyl 4-oxo-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-3-carboxylate (PubChem CID 10756340) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is methyl 4-oxo-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-3-carboxylate.
| Compound Name | methyl 4-oxo-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 10756340 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 4-oxo-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-3-carboxylate |
| SMILES | COC(=O)C1=CCC2c3[nH]c4ccccc4c3CCN2C1=O |
| InChI | InChI=1S/C17H16N2O3/c1-22-17(21)12-6-7-14-15-11(8-9-19(14)16(12)20)10-4-2-3-5-13(10)18-15/h2-6,14,18H,7-9H2,1H3 |
| InChIKey | GLBVSRWVZFRNKJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|