C19H20N2O4 — CID 14947731
dimethyl (1S,12bS)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-1,3-dicarboxylate (PubChem CID 14947731) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is dimethyl (1S,12bS)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-1,3-dicarboxylate.
| Compound Name | dimethyl (1S,12bS)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 14947731 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | dimethyl (1S,12bS)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-1,3-dicarboxylate |
| SMILES | COC(=O)C1=CN2CCc3c([nH]c4ccccc34)[C@@H]2[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C19H20N2O4/c1-24-18(22)11-9-14(19(23)25-2)17-16-13(7-8-21(17)10-11)12-5-3-4-6-15(12)20-16/h3-6,10,14,17,20H,7-9H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | UHTFXKMYNJOYIY-YOEHRIQHSA-N |
| XLogP | 2.32 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|