C21H22N2O4 — CID 10970571
dimethyl 2-(1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-3-ylmethylidene)propanedioate (PubChem CID 10970571) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is dimethyl 2-(1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-3-ylmethylidene)propanedioate.
| Compound Name | dimethyl 2-(1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-3-ylmethylidene)propanedioate |
|---|---|
| PubChem CID | 10970571 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | dimethyl 2-(1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-3-ylmethylidene)propanedioate |
| SMILES | COC(=O)C(=CC1=CN2CCc3c([nH]c4ccccc34)C2CC1)C(=O)OC |
| InChI | InChI=1S/C21H22N2O4/c1-26-20(24)16(21(25)27-2)11-13-7-8-18-19-15(9-10-23(18)12-13)14-5-3-4-6-17(14)22-19/h3-6,11-12,18,22H,7-10H2,1-2H3 |
| InChIKey | WOVJSIVRLVLYCX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|