C23H21ClN2O2 — CID 102097540
methyl (2R,12bR)-2-(3-chlorophenyl)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-3-carboxylate (PubChem CID 102097540) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is methyl (2R,12bR)-2-(3-chlorophenyl)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-3-carboxylate.
| Compound Name | methyl (2R,12bR)-2-(3-chlorophenyl)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 102097540 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | methyl (2R,12bR)-2-(3-chlorophenyl)-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-3-carboxylate |
| SMILES | COC(=O)C1=CN2CCc3c([nH]c4ccccc34)[C@H]2C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H21ClN2O2/c1-28-23(27)19-13-26-10-9-17-16-7-2-3-8-20(16)25-22(17)21(26)12-18(19)14-5-4-6-15(24)11-14/h2-8,11,13,18,21,25H,9-10,12H2,1H3/t18-,21-/m1/s1 |
| InChIKey | FUOMVGHBVKXKDD-WIYYLYMNSA-N |
| XLogP | 4.96 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|