C21H23ClN2O3 — CID 138502045
methyl (2S,3S,4R,5S,7S)-17-chloro-5-hydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate (PubChem CID 138502045) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S,7S)-17-chloro-5-hydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate.
| Compound Name | methyl (2S,3S,4R,5S,7S)-17-chloro-5-hydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate |
|---|---|
| PubChem CID | 138502045 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | methyl (2S,3S,4R,5S,7S)-17-chloro-5-hydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate |
| SMILES | COC(=O)C1=CN2CCc3c([nH]c4cc(Cl)ccc34)[C@@H]2[C@@H]2[C@@H](C)[C@@H](O)C[C@H]12 |
| InChI | InChI=1S/C21H23ClN2O3/c1-10-17(25)8-14-15(21(26)27-2)9-24-6-5-13-12-4-3-11(22)7-16(12)23-19(13)20(24)18(10)14/h3-4,7,9-10,14,17-18,20,23,25H,5-6,8H2,1-2H3/t10-,14+,17-,18+,20-/m0/s1 |
| InChIKey | UQGZAZFROTXIGL-WNOFUIEHSA-N |
| XLogP | 3.42 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|