C22H30N2O3 — CID 160529241
methyl (1R,16S)-6,16-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaene-19-carboxylate;molecular hydrogen (PubChem CID 160529241) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl (1R,16S)-6,16-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaene-19-carboxylate;molecular hydrogen.
| Compound Name | methyl (1R,16S)-6,16-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaene-19-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 160529241 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | methyl (1R,16S)-6,16-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaene-19-carboxylate;molecular hydrogen |
| SMILES | COC(=O)C1=CO[C@@H](C)C2CN3CCc4c([nH]c5cc(C)ccc45)[C@H]3CC12.[H][H].[H][H] |
| InChI | InChI=1S/C22H26N2O3.2H2/c1-12-4-5-14-15-6-7-24-10-17-13(2)27-11-18(22(25)26-3)16(17)9-20(24)21(15)23-19(14)8-12;;/h4-5,8,11,13,16-17,20,23H,6-7,9-10H2,1-3H3;2*1H/t13-,16?,17?,20+;;/m0../s1 |
| InChIKey | QVHVGVHURSODCG-SOTRZSKLSA-N |
| XLogP | 3.98 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|